| send us an inquiry |
LC546 Bis(2-ethylhexyl) adipatefor synthesis |
| Order number | Packaging | Quantity | Price € |
| AC27546 | Plastic bottle | 100 ml | 11.88 |
| AC27546 | Plastic bottle | 1 l | 13.86 |
| Product information | |
| Synonyms | Bis(2-ethylhexyl) hexanedioate, Di-(2-ethylhexyl) adipate, Diisooctyl adipate, Hexanedioic bis(2-ethylhexyl ester) |
| Hill Formula | C22H42O4 |
| Chemical formula | CH3(CH2)3CH(C2H5)CH2OOC(CH2)4COOCH2CH(C2H5)(CH2) |
| HS Code | 2917 12 00 |
| EC number | 203-090-1 |
| Molar mass | 370.57 g/mol |
| CAS number | 103-23-1 |
| Chemical and physical data | |
| Ignition temperature | 350 °C DIN 51794 |
| Solubility | < - 0.0001 g/l (20 °C) |
| Melting point | -68 – -66 °C |
| Molar mass | 370.57 g/mol |
| Density | 0.93 g/cm3 (20 °C) |
| pH value | 7 (H2O, 20 °C) |
| Boiling point | 247 – 252 °C (27 hPa) |
| Vapor pressure | < - 0.001 hPa (20 °C) |
| Flash point | 195 °C |
| Refractive index | 1.447 (20 °C, 589 nm) |
| Safety information | |
| RTECS | AU9700000 |
| Storage class | 10 Combustible liquids not in Storage Class 3 |
| WGK | WGK 1 slightly water endangering |
| Disposal | 3 Relatively unreactive organic reagents should be collected in container A. If halogenated, they should be collected in container B. For solid residues use container C. |
| Toxicological data | |
| LD 50 oral | LD50 rat > 5000 mg/kg |
| LD 50 dermal | LD50 rabbit 8410 mg/kg |
| Specifications | |
| Assay (GC, area%) | ≥ 98 % |
| Density (d 20 °C/ 4 °C) | 0.924 – 0.926 |
| Identity (IR) | passes test |
 |