| send us an inquiry |
| LC2118 Di-sec-butylamine for synthesis |
| Order number | Packaging | Quantity | Price € |
| AC29118 | Glass bottle | 250 ml | 100.80 |
| Product information | |
| Synonyms | N-(1-Methylpropyl)-2-butanamine |
| Hill Formula | C8H19N |
| Chemical formula | CH3CH2CH(CH3)NHCH(CH3)CH2CH3 |
| HS Code | 2921 19 99 |
| EC number | 210-937-9 |
| Molar mass | 129.24 g/mol |
| EC index number | 612-049-00-0 |
| CAS number | 626-23-3 |
| Chemical and physical data | |
| Ignition temperature | 320 °C |
| Solubility | 7 g/l (20 °C) |
| Melting point | -70 °C |
| Molar mass | 129.24 g/mol |
| Density | 0.75 g/cm3 (20 °C) |
| pH value | (H2O) strongly alkaline |
| Boiling point | 133 – 135 °C |
| Vapor pressure | 50 hPa (50 °C) |
| Flash point | 24 °C |
| Safety information | |
| R Phrase | R 10-20/21/22 Flammable.Harmful by inhalation, in contact with skin and if swallowed. |
| Categories of danger | flammable, harmful |
| Hazard Symbol |  harmful |
| Storage class | 3 Flammable Liquids |
| WGK | WGK 2 water endangering |
| Disposal | 3 Relatively unreactive organic reagents should be collected in container A. If halogenated, they should be collected in container B. For solid residues use container C. |
| Transport information | |
| Declaration (transport by sea) IMDG-Code | UN 2734 AMINES, LIQUID, CORROSIVE, FLAMMABLE, N.O.S.(DI-SEK-BUTYLAMINE), 8 (3), II, Segregation Group: 18 (Alkalis) |
| Declaration (transport by air) IATA-DGR | UN 2734 AMINES, LIQUID, CORROSIVE, FLAMMABLE, N.O.S.(DI-SEK-BUTYLAMINE), 8 (3), II |
| Specifications | |
| Assay (GC, area%) | ≥ 99 % |
| Density (d 20 °C/ 4 °C) | 0.752 – 0.754 |
| Water (K. F.) | ≤ 0.3 % |
| Identity (IR) | passes test |
 |