| send us an inquiry |
LC3769 Isoamyl butyratefor synthesis |
| Order number | Packaging | Quantity | Price € |
| AC30769 | Glass bottle | 250 ml | 11.61 |
| AC30769 | Glass bottle | 1 l | 30.375 |
| Product information | |
| Synonyms | Butyric acid (3-methylbutyl ester) |
| Hill Formula | C9H18O2 |
| Chemicalformula | CH3CH2CH2COOCH2CH2CH(CH3)2 |
| HS Code | 2915 60 19 |
| EC number | 203-380-8 |
| Molar mass | 158.24 g/mol |
| CAS number | 106-27-4 |
| Chemical and physical data | |
| Solubility | 0.5 g/l (50 °C) |
| Melting point | -73 °C |
| Molar mass | 158.24 g/mol |
| Density | 0.88 g/cm3 (20 °C) |
| Boiling point | 178 °C |
| Vapor pressure | 1.1 hPa (20 °C) |
| Flash point | 59 °C |
| Safety information | |
| R Phrase | R 52/53 Harmful to aquatic organisms, may cause long-term adverse effects in the aquatic environment. |
| S Phrase | S 24-61 Avoid contact with skin.Avoid release to the environment. Refer to special instructions/ Safety data sheets. |
| Categories of danger | dangerous for the environment |
| Storage class | 10 Combustible liquids not in Storage Class 3 |
| WGK | WGK 1 slightly water endangering |
| Disposal | 3 Relatively unreactive organic reagents should be collected in container A. If halogenated, they should be collected in container B. For solid residues use container C. |
| Transport information | |
| Declaration (transport by sea) IMDG-Code | UN 2620 AMYL BUTYRATES, 3, III |
| Declaration (transport by air) IATA-DGR | UN 2620 AMYL BUTYRATES, 3, III |
| Toxicological data | |
| LD 50 oral | LD50 rat > 5000 mg/kg |
| LD 50 dermal | LD50 rabbit > 5000 mg/kg |
| Specifications | |
| Assay (GC, area%) | ≥ 98 % |
| Density (d 20 °C/ 4 °C) | 0.860 – 0.864 |
| Identity (IR) | passes test |
 |