| send us an inquiry |
LC3575 Linaloolfor synthesis |
| Order number | Packaging | Quantity | Price € |
| AC30575 | Glass bottle | 25 ml | 10.89 |
| AC30575 | Glass bottle | 250 ml | 25.88 |
| Product information | |
| Synonyms | 3,7-Dimethyl-1,6-octadien-3-ol |
| Hill Formula | C10H18O |
| Chemical formula | CH3C(CH3)=CH(CH2)2C(OH)(CH3)CH=CH2 |
| HS Code | 2905 22 00 |
| EC number | 201-134-4 |
| Molar mass | 154.25 g/mol |
| CAS number | 5989-54-8 |
| Chemical and physical data | |
| Ignition temperature | 235 °C |
| Solubility | 1.45 g/l (20 °C) |
| Molar mass | 154.25 g/mol |
| Density | 0.86 g/cm3 (20 °C) |
| pH value | 4.5 (1.45 g/l, H2O, 25 °C) |
| Boiling point | 198 – 200 °C |
| Vapor pressure | 0.10 hPa (20 °C) |
| Explosion limit | 0.9 – 5.2 %(V) |
| Flash point | 79 °C |
| Refractive index | 1.462 (20 °C, 589 nm) |
| Safety information according to GHS | |
| Hazard Statement(s) | H315: Causes skin irritation. |
| Precautionary Statement(s) | P302 + P352: IF ON SKIN: Wash with plenty of soap and water. |
| Signal Word | Warning |
| Hazard Pictogram(s) |  |
| Storage class | 10 Combustible liquids not in Storage Class 3 |
| WGK | WGK 1 slightly water endangering |
| Disposal | 3 Relatively unreactive organic reagents should be collected in container A. If halogenated, they should be collected in container B. For solid residues use container C. |
| Safety information | |
| R Phrase | R 38 Irritating to skin. |
| Categories of danger | irritant |
| Hazard Symbol |  Irritant |
| Toxicological data | |
| LD 50 oral | LD50 rat 2790 mg/kg |
| LD 50 dermal | LD50 rabbit 5610 mg/kg |
| Specifications | |
| Assay (GC, area%) | ≥ 97 % |
| Density (d 20 °C/ 4 °C) | 0.860 – 0.862 |
| Identity (IR) | passes test |
 |